Fosbretabulin (disodium) - CAS# 168555-66-6 od Hydrochloride InChi: InChI=1S/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H

InChi: InChI=1S/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H

CAS Number: 182431-12-5

decreases release of pro-inflammatory cytokines

hippocampus

Seiwert SD

Fosbretabulin (disodium) - CAS# 168555-66-6 od Hydrochloride InChi: InChI=1S/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7HFosbretabulin disodium is the disodium salt of a water soluble phosphate derivative of a natural stilbenoid phenol derived from the African bush willow (Combretum caffrum) with potential vascular disrupting and antineoplastic activities. Upon administration, the prodrug fosbretabulin is dephosphorylated to its active metabolite, the microtubule depolymerizing agent combretastatin A4, which binds to tubulin dimers and prevents microtubule